About (2,4-diaminoquinazolin-6-yl)methyl 3-(2,6-dimethoxyphenyl)benzoate
(2,4-diaminoquinazolin-6-yl)methyl 3-(2,6-dimethoxyphenyl)benzoate (PubChem CID 3008600) has the molecular formula C24H22N4O4
and a molecular weight of 430.46 g/mol. Its IUPAC name is (2,4-diaminoquinazolin-6-yl)methyl 3-(2,6-dimethoxyphenyl)benzoate.
Molecular Properties
| Compound Name | (2,4-diaminoquinazolin-6-yl)methyl 3-(2,6-dimethoxyphenyl)benzoate |
| PubChem CID | 3008600 |
| Molecular Formula | C24H22N4O4 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | (2,4-diaminoquinazolin-6-yl)methyl 3-(2,6-dimethoxyphenyl)benzoate |
| SMILES | COc1cccc(OC)c1-c1cccc(C(=O)OCc2ccc3nc(N)nc(N)c3c2)c1 |
| InChI | InChI=1S/C24H22N4O4/c1-30-19-7-4-8-20(31-2)21(19)15-5-3-6-16(12-15)23(29)32-13-14-9-10-18-17(11-14)22(25)28-24(26)27-18/h3-12H,13H2,1-2H3,(H4,25,26,27,28) |
| InChIKey | VHUMDNIVMQRTJS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 122.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (2,4-diaminoquinazolin-6-yl)methyl 3-(2,6-dimethoxyphenyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-diaminoquinazolin-6-yl)methyl 3-(2,6-dimethoxyphenyl)benzoate?
The IUPAC name of (2,4-diaminoquinazolin-6-yl)methyl 3-(2,6-dimethoxyphenyl)benzoate (CID 3008600) is (2,4-diaminoquinazolin-6-yl)methyl 3-(2,6-dimethoxyphenyl)benzoate.
What is the SMILES notation for (2,4-diaminoquinazolin-6-yl)methyl 3-(2,6-dimethoxyphenyl)benzoate?
The canonical SMILES for (2,4-diaminoquinazolin-6-yl)methyl 3-(2,6-dimethoxyphenyl)benzoate is COc1cccc(OC)c1-c1cccc(C(=O)OCc2ccc3nc(N)nc(N)c3c2)c1.
What is the InChIKey of (2,4-diaminoquinazolin-6-yl)methyl 3-(2,6-dimethoxyphenyl)benzoate?
The InChIKey is VHUMDNIVMQRTJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N4O4/c1-30-19-7-4-8-20(31-2)21(19)15-5-3-6-16(12-15)23(29)32-13-14-9-10-18-17(11-14)22(25)28-24(26)27-18/h3-12H,13H2,1-2H3,(H4,25,26,27,28).
What are the key properties of (2,4-diaminoquinazolin-6-yl)methyl 3-(2,6-dimethoxyphenyl)benzoate?
(2,4-diaminoquinazolin-6-yl)methyl 3-(2,6-dimethoxyphenyl)benzoate has a molecular weight of 430.46 g/mol, XLogP of 3.84, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-diaminoquinazolin-6-yl)methyl 3-(2,6-dimethoxyphenyl)benzoate is sourced from PubChem (CID 3008600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).