About (2,4-diaminoquinazolin-6-yl)methyl 3,5-dimethylbenzoate
(2,4-diaminoquinazolin-6-yl)methyl 3,5-dimethylbenzoate (PubChem CID 3008601) has the molecular formula C18H18N4O2
and a molecular weight of 322.37 g/mol. Its IUPAC name is (2,4-diaminoquinazolin-6-yl)methyl 3,5-dimethylbenzoate.
Molecular Properties
| Compound Name | (2,4-diaminoquinazolin-6-yl)methyl 3,5-dimethylbenzoate |
| PubChem CID | 3008601 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | (2,4-diaminoquinazolin-6-yl)methyl 3,5-dimethylbenzoate |
| SMILES | Cc1cc(C)cc(C(=O)OCc2ccc3nc(N)nc(N)c3c2)c1 |
| InChI | InChI=1S/C18H18N4O2/c1-10-5-11(2)7-13(6-10)17(23)24-9-12-3-4-15-14(8-12)16(19)22-18(20)21-15/h3-8H,9H2,1-2H3,(H4,19,20,21,22) |
| InChIKey | KNSDDLROLPQGQN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2,4-diaminoquinazolin-6-yl)methyl 3,5-dimethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-diaminoquinazolin-6-yl)methyl 3,5-dimethylbenzoate?
The IUPAC name of (2,4-diaminoquinazolin-6-yl)methyl 3,5-dimethylbenzoate (CID 3008601) is (2,4-diaminoquinazolin-6-yl)methyl 3,5-dimethylbenzoate.
What is the SMILES notation for (2,4-diaminoquinazolin-6-yl)methyl 3,5-dimethylbenzoate?
The canonical SMILES for (2,4-diaminoquinazolin-6-yl)methyl 3,5-dimethylbenzoate is Cc1cc(C)cc(C(=O)OCc2ccc3nc(N)nc(N)c3c2)c1.
What is the InChIKey of (2,4-diaminoquinazolin-6-yl)methyl 3,5-dimethylbenzoate?
The InChIKey is KNSDDLROLPQGQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4O2/c1-10-5-11(2)7-13(6-10)17(23)24-9-12-3-4-15-14(8-12)16(19)22-18(20)21-15/h3-8H,9H2,1-2H3,(H4,19,20,21,22).
What are the key properties of (2,4-diaminoquinazolin-6-yl)methyl 3,5-dimethylbenzoate?
(2,4-diaminoquinazolin-6-yl)methyl 3,5-dimethylbenzoate has a molecular weight of 322.37 g/mol, XLogP of 2.77, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-diaminoquinazolin-6-yl)methyl 3,5-dimethylbenzoate is sourced from PubChem (CID 3008601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).