C21H32O3 — CID 3008605
(1S,4R,4aS,4bS,6R,7S,10aR)-7-ethenyl-1-ethyl-4,6-dihydroxy-1,4a,7-trimethyl-3,4,4b,5,6,9,10,10a-octahydrophenanthren-2-one (PubChem CID 3008605) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is (1S,4R,4aS,4bS,6R,7S,10aR)-7-ethenyl-1-ethyl-4,6-dihydroxy-1,4a,7-trimethyl-3,4,4b,5,6,9,10,10a-octahydrophenanthren-2-one.
| Compound Name | (1S,4R,4aS,4bS,6R,7S,10aR)-7-ethenyl-1-ethyl-4,6-dihydroxy-1,4a,7-trimethyl-3,4,4b,5,6,9,10,10a-octahydrophenanthren-2-one |
|---|---|
| PubChem CID | 3008605 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (1S,4R,4aS,4bS,6R,7S,10aR)-7-ethenyl-1-ethyl-4,6-dihydroxy-1,4a,7-trimethyl-3,4,4b,5,6,9,10,10a-octahydrophenanthren-2-one |
| SMILES | C=C[C@@]1(C)C=C2CC[C@@H]3[C@@](C)([C@H](O)CC(=O)[C@@]3(C)CC)[C@H]2C[C@H]1O |
| InChI | InChI=1S/C21H32O3/c1-6-19(3)12-13-8-9-15-20(4,7-2)17(23)11-18(24)21(15,5)14(13)10-16(19)22/h6,12,14-16,18,22,24H,1,7-11H2,2-5H3/t14-,15-,16+,18+,19-,20-,21-/m0/s1 |
| InChIKey | GQUWXJDJNAWHNN-MKIDGPAKSA-N |
| XLogP | 3.65 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|