C13H27NSSn — CID 3008667
[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylsulfanyl-trimethylstannane (PubChem CID 3008667) has the molecular formula C13H27NSSn and a molecular weight of 348.14 g/mol. Its IUPAC name is [(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylsulfanyl-trimethylstannane.
| Compound Name | [(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylsulfanyl-trimethylstannane |
|---|---|
| PubChem CID | 3008667 |
| Molecular Formula | C13H27NSSn |
| Molecular Weight | 348.14 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | [(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylsulfanyl-trimethylstannane |
| SMILES | C[Sn](C)(C)SC[C@@H]1CCCN2CCCC[C@H]12 |
| InChI | InChI=1S/C10H19NS.3CH3.Sn/c12-8-9-4-3-7-11-6-2-1-5-10(9)11;;;;/h9-10,12H,1-8H2;3*1H3;/q;;;;+1/p-1/t9-,10+;;;;/m0..../s1 |
| InChIKey | JZPZREGDQKOAMB-VQTXXYAFSA-M |
| XLogP | 3.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.14 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |