C31H48N4O7S2 — CID 3009308
N-[5-[(4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-3-[5-(methanesulfonamido)pentyl]-2-oxo-1,3-diazepan-1-yl]pentyl]methanesulfonamide (PubChem CID 3009308) has the molecular formula C31H48N4O7S2 and a molecular weight of 652.88 g/mol. Its IUPAC name is N-[5-[(4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-3-[5-(methanesulfonamido)pentyl]-2-oxo-1,3-diazepan-1-yl]pentyl]methanesulfonamide.
| Compound Name | N-[5-[(4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-3-[5-(methanesulfonamido)pentyl]-2-oxo-1,3-diazepan-1-yl]pentyl]methanesulfonamide |
|---|---|
| PubChem CID | 3009308 |
| Molecular Formula | C31H48N4O7S2 |
| Molecular Weight | 652.88 g/mol |
| Exact Mass | 652.30 |
| IUPAC Name | N-[5-[(4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-3-[5-(methanesulfonamido)pentyl]-2-oxo-1,3-diazepan-1-yl]pentyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCCCN1C(=O)N(CCCCCNS(C)(=O)=O)[C@H](Cc2ccccc2)[C@H](O)[C@@H](O)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C31H48N4O7S2/c1-43(39,40)32-19-11-5-13-21-34-27(23-25-15-7-3-8-16-25)29(36)30(37)28(24-26-17-9-4-10-18-26)35(31(34)38)22-14-6-12-20-33-44(2,41)42/h3-4,7-10,15-18,27-30,32-33,36-37H,5-6,11-14,19-24H2,1-2H3/t27-,28-,29+,30+/m1/s1 |
| InChIKey | SPFDDOLVNJYPAH-XAZDILKDSA-N |
| XLogP | 2.11 |
| TPSA | 156.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.88 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|