C43H50F2N4O5 — CID 3009312
N-[5-[(4R,5S,6S,7R)-4,7-dibenzyl-3-[5-[(4-fluorobenzoyl)amino]pentyl]-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]pentyl]-4-fluorobenzamide (PubChem CID 3009312) has the molecular formula C43H50F2N4O5 and a molecular weight of 740.89 g/mol. Its IUPAC name is N-[5-[(4R,5S,6S,7R)-4,7-dibenzyl-3-[5-[(4-fluorobenzoyl)amino]pentyl]-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]pentyl]-4-fluorobenzamide.
| Compound Name | N-[5-[(4R,5S,6S,7R)-4,7-dibenzyl-3-[5-[(4-fluorobenzoyl)amino]pentyl]-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]pentyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 3009312 |
| Molecular Formula | C43H50F2N4O5 |
| Molecular Weight | 740.89 g/mol |
| Exact Mass | 740.37 |
| IUPAC Name | N-[5-[(4R,5S,6S,7R)-4,7-dibenzyl-3-[5-[(4-fluorobenzoyl)amino]pentyl]-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]pentyl]-4-fluorobenzamide |
| SMILES | O=C(NCCCCCN1C(=O)N(CCCCCNC(=O)c2ccc(F)cc2)[C@H](Cc2ccccc2)[C@H](O)[C@@H](O)[C@H]1Cc1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C43H50F2N4O5/c44-35-21-17-33(18-22-35)41(52)46-25-9-3-11-27-48-37(29-31-13-5-1-6-14-31)39(50)40(51)38(30-32-15-7-2-8-16-32)49(43(48)54)28-12-4-10-26-47-42(53)34-19-23-36(45)24-20-34/h1-2,5-8,13-24,37-40,50-51H,3-4,9-12,25-30H2,(H,46,52)(H,47,53)/t37-,38-,39+,40+/m1/s1 |
| InChIKey | VMAACENPBLBGNM-WESAGZJESA-N |
| XLogP | 6.15 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.89 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|