C20H30O4 — CID 3009628
(1R,4aR,5R,8aR)-6-formyl-1,4a-dimethyl-5-(4-methyl-3-oxopentyl)-2,3,4,5,8,8a-hexahydronaphthalene-1-carboxylic acid (PubChem CID 3009628) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (1R,4aR,5R,8aR)-6-formyl-1,4a-dimethyl-5-(4-methyl-3-oxopentyl)-2,3,4,5,8,8a-hexahydronaphthalene-1-carboxylic acid.
| Compound Name | (1R,4aR,5R,8aR)-6-formyl-1,4a-dimethyl-5-(4-methyl-3-oxopentyl)-2,3,4,5,8,8a-hexahydronaphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 3009628 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (1R,4aR,5R,8aR)-6-formyl-1,4a-dimethyl-5-(4-methyl-3-oxopentyl)-2,3,4,5,8,8a-hexahydronaphthalene-1-carboxylic acid |
| SMILES | CC(C)C(=O)CC[C@H]1C(C=O)=CC[C@@H]2[C@]1(C)CCC[C@@]2(C)C(=O)O |
| InChI | InChI=1S/C20H30O4/c1-13(2)16(22)8-7-15-14(12-21)6-9-17-19(15,3)10-5-11-20(17,4)18(23)24/h6,12-13,15,17H,5,7-11H2,1-4H3,(H,23,24)/t15-,17+,19+,20+/m0/s1 |
| InChIKey | UCRJIYGYSLKACR-JQERWDHBSA-N |
| XLogP | 4.03 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|