C11H17N3O7S — CID 3009797
ethyl 2-(2-acetyloxyethoxymethyl)-5-amino-1,1-dioxo-1,2,6-thiadiazine-4-carboxylate (PubChem CID 3009797) has the molecular formula C11H17N3O7S and a molecular weight of 335.34 g/mol. Its IUPAC name is ethyl 2-(2-acetyloxyethoxymethyl)-5-amino-1,1-dioxo-1,2,6-thiadiazine-4-carboxylate.
| Compound Name | ethyl 2-(2-acetyloxyethoxymethyl)-5-amino-1,1-dioxo-1,2,6-thiadiazine-4-carboxylate |
|---|---|
| PubChem CID | 3009797 |
| Molecular Formula | C11H17N3O7S |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | ethyl 2-(2-acetyloxyethoxymethyl)-5-amino-1,1-dioxo-1,2,6-thiadiazine-4-carboxylate |
| SMILES | CCOC(=O)C1=CN(COCCOC(C)=O)S(=O)(=O)N=C1N |
| InChI | InChI=1S/C11H17N3O7S/c1-3-20-11(16)9-6-14(22(17,18)13-10(9)12)7-19-4-5-21-8(2)15/h6H,3-5,7H2,1-2H3,(H2,12,13) |
| InChIKey | GZNLSWDQKSWFNC-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 137.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|