About 1'-propan-2-ylspiro[adamantane-2,3'-pyrrolidine]
1'-propan-2-ylspiro[adamantane-2,3'-pyrrolidine] (PubChem CID 3009948) has the molecular formula C16H27N
and a molecular weight of 233.40 g/mol. Its IUPAC name is 1'-propan-2-ylspiro[adamantane-2,3'-pyrrolidine].
Molecular Properties
| Compound Name | 1'-propan-2-ylspiro[adamantane-2,3'-pyrrolidine] |
| PubChem CID | 3009948 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 1'-propan-2-ylspiro[adamantane-2,3'-pyrrolidine] |
| SMILES | CC(C)N1CCC2(C1)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C16H27N/c1-11(2)17-4-3-16(10-17)14-6-12-5-13(8-14)9-15(16)7-12/h11-15H,3-10H2,1-2H3 |
| InChIKey | CPBNHIMAMKDTHI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1'-propan-2-ylspiro[adamantane-2,3'-pyrrolidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-propan-2-ylspiro[adamantane-2,3'-pyrrolidine]?
The IUPAC name of 1'-propan-2-ylspiro[adamantane-2,3'-pyrrolidine] (CID 3009948) is 1'-propan-2-ylspiro[adamantane-2,3'-pyrrolidine].
What is the SMILES notation for 1'-propan-2-ylspiro[adamantane-2,3'-pyrrolidine]?
The canonical SMILES for 1'-propan-2-ylspiro[adamantane-2,3'-pyrrolidine] is CC(C)N1CCC2(C1)C1CC3CC(C1)CC2C3.
What is the InChIKey of 1'-propan-2-ylspiro[adamantane-2,3'-pyrrolidine]?
The InChIKey is CPBNHIMAMKDTHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N/c1-11(2)17-4-3-16(10-17)14-6-12-5-13(8-14)9-15(16)7-12/h11-15H,3-10H2,1-2H3.
What are the key properties of 1'-propan-2-ylspiro[adamantane-2,3'-pyrrolidine]?
1'-propan-2-ylspiro[adamantane-2,3'-pyrrolidine] has a molecular weight of 233.40 g/mol, XLogP of 3.54, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-propan-2-ylspiro[adamantane-2,3'-pyrrolidine] is sourced from PubChem (CID 3009948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).