About 2-amino-9-(1,3-dihydroxypropan-2-yloxymethyl)-3H-purine-6-thione
2-amino-9-(1,3-dihydroxypropan-2-yloxymethyl)-3H-purine-6-thione (PubChem CID 3010097) has the molecular formula C9H13N5O3S
and a molecular weight of 271.30 g/mol. Its IUPAC name is 2-amino-9-(1,3-dihydroxypropan-2-yloxymethyl)-3H-purine-6-thione.
Molecular Properties
| Compound Name | 2-amino-9-(1,3-dihydroxypropan-2-yloxymethyl)-3H-purine-6-thione |
| PubChem CID | 3010097 |
| Molecular Formula | C9H13N5O3S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 2-amino-9-(1,3-dihydroxypropan-2-yloxymethyl)-3H-purine-6-thione |
| SMILES | Nc1nc(=S)c2ncn(COC(CO)CO)c2[nH]1 |
| InChI | InChI=1S/C9H13N5O3S/c10-9-12-7-6(8(18)13-9)11-3-14(7)4-17-5(1-15)2-16/h3,5,15-16H,1-2,4H2,(H3,10,12,13,18) |
| InChIKey | AGUPDOJSDKRWOG-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-9-(1,3-dihydroxypropan-2-yloxymethyl)-3H-purine-6-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-9-(1,3-dihydroxypropan-2-yloxymethyl)-3H-purine-6-thione?
The IUPAC name of 2-amino-9-(1,3-dihydroxypropan-2-yloxymethyl)-3H-purine-6-thione (CID 3010097) is 2-amino-9-(1,3-dihydroxypropan-2-yloxymethyl)-3H-purine-6-thione.
What is the SMILES notation for 2-amino-9-(1,3-dihydroxypropan-2-yloxymethyl)-3H-purine-6-thione?
The canonical SMILES for 2-amino-9-(1,3-dihydroxypropan-2-yloxymethyl)-3H-purine-6-thione is Nc1nc(=S)c2ncn(COC(CO)CO)c2[nH]1.
What is the InChIKey of 2-amino-9-(1,3-dihydroxypropan-2-yloxymethyl)-3H-purine-6-thione?
The InChIKey is AGUPDOJSDKRWOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N5O3S/c10-9-12-7-6(8(18)13-9)11-3-14(7)4-17-5(1-15)2-16/h3,5,15-16H,1-2,4H2,(H3,10,12,13,18).
What are the key properties of 2-amino-9-(1,3-dihydroxypropan-2-yloxymethyl)-3H-purine-6-thione?
2-amino-9-(1,3-dihydroxypropan-2-yloxymethyl)-3H-purine-6-thione has a molecular weight of 271.30 g/mol, XLogP of -0.60, 5 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-9-(1,3-dihydroxypropan-2-yloxymethyl)-3H-purine-6-thione is sourced from PubChem (CID 3010097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).