C19H18O7 — CID 3010100
2-(4-hydroxyphenyl)-5,6,7,8-tetramethoxychromen-4-one (PubChem CID 3010100) has the molecular formula C19H18O7 and a molecular weight of 358.35 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-5,6,7,8-tetramethoxychromen-4-one.
| Compound Name | 2-(4-hydroxyphenyl)-5,6,7,8-tetramethoxychromen-4-one |
|---|---|
| PubChem CID | 3010100 |
| Molecular Formula | C19H18O7 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2-(4-hydroxyphenyl)-5,6,7,8-tetramethoxychromen-4-one |
| SMILES | COc1c(OC)c(OC)c2c(=O)cc(-c3ccc(O)cc3)oc2c1OC |
| InChI | InChI=1S/C19H18O7/c1-22-15-14-12(21)9-13(10-5-7-11(20)8-6-10)26-16(14)18(24-3)19(25-4)17(15)23-2/h5-9,20H,1-4H3 |
| InChIKey | IECRXMSGDFIOEY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |