C14H18F2N2O2 — CID 30101240
N-(3,4-difluorophenyl)-3-(4-hydroxypiperidin-1-yl)propanamide (PubChem CID 30101240) has the molecular formula C14H18F2N2O2 and a molecular weight of 284.31 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-3-(4-hydroxypiperidin-1-yl)propanamide.
| Compound Name | N-(3,4-difluorophenyl)-3-(4-hydroxypiperidin-1-yl)propanamide |
|---|---|
| PubChem CID | 30101240 |
| Molecular Formula | C14H18F2N2O2 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | N-(3,4-difluorophenyl)-3-(4-hydroxypiperidin-1-yl)propanamide |
| SMILES | O=C(CCN1CCC(O)CC1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H18F2N2O2/c15-12-2-1-10(9-13(12)16)17-14(20)5-8-18-6-3-11(19)4-7-18/h1-2,9,11,19H,3-8H2,(H,17,20) |
| InChIKey | SCTIDKKXFBDKNH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |