C38H50N4O5 — CID 3010242
(2S)-N-[(2S,4S,5S)-5-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methyl-2-(3-methyl-2-oxo-1,3-diazinan-1-yl)butanamide (PubChem CID 3010242) has the molecular formula C38H50N4O5 and a molecular weight of 642.84 g/mol. Its IUPAC name is (2S)-N-[(2S,4S,5S)-5-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methyl-2-(3-methyl-2-oxo-1,3-diazinan-1-yl)butanamide.
| Compound Name | (2S)-N-[(2S,4S,5S)-5-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methyl-2-(3-methyl-2-oxo-1,3-diazinan-1-yl)butanamide |
|---|---|
| PubChem CID | 3010242 |
| Molecular Formula | C38H50N4O5 |
| Molecular Weight | 642.84 g/mol |
| Exact Mass | 642.38 |
| IUPAC Name | (2S)-N-[(2S,4S,5S)-5-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methyl-2-(3-methyl-2-oxo-1,3-diazinan-1-yl)butanamide |
| SMILES | Cc1cccc(C)c1OCC(=O)N[C@@H](Cc1ccccc1)[C@@H](O)C[C@H](Cc1ccccc1)NC(=O)[C@H](C(C)C)N1CCCN(C)C1=O |
| InChI | InChI=1S/C38H50N4O5/c1-26(2)35(42-21-13-20-41(5)38(42)46)37(45)39-31(22-29-16-8-6-9-17-29)24-33(43)32(23-30-18-10-7-11-19-30)40-34(44)25-47-36-27(3)14-12-15-28(36)4/h6-12,14-19,26,31-33,35,43H,13,20-25H2,1-5H3,(H,39,45)(H,40,44)/t31-,32-,33-,35-/m0/s1 |
| InChIKey | UDZJYEUABYTYDF-TUCRWICHSA-N |
| XLogP | 4.67 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.84 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |