About 7-benzamidonaphthalene-1,3-disulfonate
7-benzamidonaphthalene-1,3-disulfonate (PubChem CID 3010326) has the molecular formula C17H11NO7S2-2
and a molecular weight of 405.41 g/mol. Its IUPAC name is 7-benzamidonaphthalene-1,3-disulfonate.
Molecular Properties
| Compound Name | 7-benzamidonaphthalene-1,3-disulfonate |
| PubChem CID | 3010326 |
| Molecular Formula | C17H11NO7S2-2 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.00 |
| IUPAC Name | 7-benzamidonaphthalene-1,3-disulfonate |
| SMILES | O=C(Nc1ccc2cc(S(=O)(=O)[O-])cc(S(=O)(=O)[O-])c2c1)c1ccccc1 |
| InChI | InChI=1S/C17H13NO7S2/c19-17(11-4-2-1-3-5-11)18-13-7-6-12-8-14(26(20,21)22)10-16(15(12)9-13)27(23,24)25/h1-10H,(H,18,19)(H,20,21,22)(H,23,24,25)/p-2 |
| InChIKey | COKIPWKRXGZENR-UHFFFAOYSA-L |
| XLogP | 1.90 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 7-benzamidonaphthalene-1,3-disulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-benzamidonaphthalene-1,3-disulfonate?
The IUPAC name of 7-benzamidonaphthalene-1,3-disulfonate (CID 3010326) is 7-benzamidonaphthalene-1,3-disulfonate.
What is the SMILES notation for 7-benzamidonaphthalene-1,3-disulfonate?
The canonical SMILES for 7-benzamidonaphthalene-1,3-disulfonate is O=C(Nc1ccc2cc(S(=O)(=O)[O-])cc(S(=O)(=O)[O-])c2c1)c1ccccc1.
What is the InChIKey of 7-benzamidonaphthalene-1,3-disulfonate?
The InChIKey is COKIPWKRXGZENR-UHFFFAOYSA-L. The full InChI is InChI=1S/C17H13NO7S2/c19-17(11-4-2-1-3-5-11)18-13-7-6-12-8-14(26(20,21)22)10-16(15(12)9-13)27(23,24)25/h1-10H,(H,18,19)(H,20,21,22)(H,23,24,25)/p-2.
What are the key properties of 7-benzamidonaphthalene-1,3-disulfonate?
7-benzamidonaphthalene-1,3-disulfonate has a molecular weight of 405.41 g/mol, XLogP of 1.90, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-benzamidonaphthalene-1,3-disulfonate is sourced from PubChem (CID 3010326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).