About 3-amino-4-hydroxynaphthalene-2,7-disulfonate
3-amino-4-hydroxynaphthalene-2,7-disulfonate (PubChem CID 3010336) has the molecular formula C10H7NO7S2-2
and a molecular weight of 317.30 g/mol. Its IUPAC name is 3-amino-4-hydroxynaphthalene-2,7-disulfonate.
Molecular Properties
| Compound Name | 3-amino-4-hydroxynaphthalene-2,7-disulfonate |
| PubChem CID | 3010336 |
| Molecular Formula | C10H7NO7S2-2 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 316.97 |
| IUPAC Name | 3-amino-4-hydroxynaphthalene-2,7-disulfonate |
| SMILES | Nc1c(S(=O)(=O)[O-])cc2cc(S(=O)(=O)[O-])ccc2c1O |
| InChI | InChI=1S/C10H9NO7S2/c11-9-8(20(16,17)18)4-5-3-6(19(13,14)15)1-2-7(5)10(9)12/h1-4,12H,11H2,(H,13,14,15)(H,16,17,18)/p-2 |
| InChIKey | MTIBLCIOPCKHAL-UHFFFAOYSA-L |
| XLogP | -0.06 |
| TPSA | 160.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4-hydroxynaphthalene-2,7-disulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-hydroxynaphthalene-2,7-disulfonate?
The IUPAC name of 3-amino-4-hydroxynaphthalene-2,7-disulfonate (CID 3010336) is 3-amino-4-hydroxynaphthalene-2,7-disulfonate.
What is the SMILES notation for 3-amino-4-hydroxynaphthalene-2,7-disulfonate?
The canonical SMILES for 3-amino-4-hydroxynaphthalene-2,7-disulfonate is Nc1c(S(=O)(=O)[O-])cc2cc(S(=O)(=O)[O-])ccc2c1O.
What is the InChIKey of 3-amino-4-hydroxynaphthalene-2,7-disulfonate?
The InChIKey is MTIBLCIOPCKHAL-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H9NO7S2/c11-9-8(20(16,17)18)4-5-3-6(19(13,14)15)1-2-7(5)10(9)12/h1-4,12H,11H2,(H,13,14,15)(H,16,17,18)/p-2.
What are the key properties of 3-amino-4-hydroxynaphthalene-2,7-disulfonate?
3-amino-4-hydroxynaphthalene-2,7-disulfonate has a molecular weight of 317.30 g/mol, XLogP of -0.06, 2 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-hydroxynaphthalene-2,7-disulfonate is sourced from PubChem (CID 3010336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).