About 4-hydroxynaphthalene-2,7-disulfonate
4-hydroxynaphthalene-2,7-disulfonate (PubChem CID 3010341) has the molecular formula C10H6O7S2-2
and a molecular weight of 302.28 g/mol. Its IUPAC name is 4-hydroxynaphthalene-2,7-disulfonate.
Molecular Properties
| Compound Name | 4-hydroxynaphthalene-2,7-disulfonate |
| PubChem CID | 3010341 |
| Molecular Formula | C10H6O7S2-2 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 301.96 |
| IUPAC Name | 4-hydroxynaphthalene-2,7-disulfonate |
| SMILES | O=S(=O)([O-])c1ccc2c(O)cc(S(=O)(=O)[O-])cc2c1 |
| InChI | InChI=1S/C10H8O7S2/c11-10-5-8(19(15,16)17)4-6-3-7(18(12,13)14)1-2-9(6)10/h1-5,11H,(H,12,13,14)(H,15,16,17)/p-2 |
| InChIKey | TZBROGJRQUABOK-UHFFFAOYSA-L |
| XLogP | 0.35 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxynaphthalene-2,7-disulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxynaphthalene-2,7-disulfonate?
The IUPAC name of 4-hydroxynaphthalene-2,7-disulfonate (CID 3010341) is 4-hydroxynaphthalene-2,7-disulfonate.
What is the SMILES notation for 4-hydroxynaphthalene-2,7-disulfonate?
The canonical SMILES for 4-hydroxynaphthalene-2,7-disulfonate is O=S(=O)([O-])c1ccc2c(O)cc(S(=O)(=O)[O-])cc2c1.
What is the InChIKey of 4-hydroxynaphthalene-2,7-disulfonate?
The InChIKey is TZBROGJRQUABOK-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H8O7S2/c11-10-5-8(19(15,16)17)4-6-3-7(18(12,13)14)1-2-9(6)10/h1-5,11H,(H,12,13,14)(H,15,16,17)/p-2.
What are the key properties of 4-hydroxynaphthalene-2,7-disulfonate?
4-hydroxynaphthalene-2,7-disulfonate has a molecular weight of 302.28 g/mol, XLogP of 0.35, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxynaphthalene-2,7-disulfonate is sourced from PubChem (CID 3010341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).