C35H48N4O8S — CID 3010467
3-[(5S)-5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(3,4-dimethoxyphenyl)methyl]urea (PubChem CID 3010467) has the molecular formula C35H48N4O8S and a molecular weight of 684.86 g/mol. Its IUPAC name is 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(3,4-dimethoxyphenyl)methyl]urea.
| Compound Name | 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(3,4-dimethoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 3010467 |
| Molecular Formula | C35H48N4O8S |
| Molecular Weight | 684.86 g/mol |
| Exact Mass | 684.32 |
| IUPAC Name | 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(3,4-dimethoxyphenyl)methyl]urea |
| SMILES | COc1ccc(CN(Cc2ccc3c(c2)OCO3)C(=O)NCCCC[C@@H](CO)N(CCC(C)C)S(=O)(=O)c2ccc(N)cc2)cc1OC |
| InChI | InChI=1S/C35H48N4O8S/c1-25(2)16-18-39(48(42,43)30-12-10-28(36)11-13-30)29(23-40)7-5-6-17-37-35(41)38(21-26-8-14-31(44-3)33(19-26)45-4)22-27-9-15-32-34(20-27)47-24-46-32/h8-15,19-20,25,29,40H,5-7,16-18,21-24,36H2,1-4H3,(H,37,41)/t29-/m0/s1 |
| InChIKey | RDXCKRVQYQGLCC-LJAQVGFWSA-N |
| XLogP | 4.99 |
| TPSA | 152.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.86 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|