About N-[4-[5-[(dimethylamino)methylamino]-1-benzofuran-2-yl]phenyl]-N',N'-dimethylmethanediamine
N-[4-[5-[(dimethylamino)methylamino]-1-benzofuran-2-yl]phenyl]-N',N'-dimethylmethanediamine (PubChem CID 3010567) has the molecular formula C20H26N4O
and a molecular weight of 338.46 g/mol. Its IUPAC name is N-[4-[5-[(dimethylamino)methylamino]-1-benzofuran-2-yl]phenyl]-N',N'-dimethylmethanediamine.
Molecular Properties
| Compound Name | N-[4-[5-[(dimethylamino)methylamino]-1-benzofuran-2-yl]phenyl]-N',N'-dimethylmethanediamine |
| PubChem CID | 3010567 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | N-[4-[5-[(dimethylamino)methylamino]-1-benzofuran-2-yl]phenyl]-N',N'-dimethylmethanediamine |
| SMILES | CN(C)CNc1ccc(-c2cc3cc(NCN(C)C)ccc3o2)cc1 |
| InChI | InChI=1S/C20H26N4O/c1-23(2)13-21-17-7-5-15(6-8-17)20-12-16-11-18(22-14-24(3)4)9-10-19(16)25-20/h5-12,21-22H,13-14H2,1-4H3 |
| InChIKey | OMBMWLJOABAXKT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 43.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[5-[(dimethylamino)methylamino]-1-benzofuran-2-yl]phenyl]-N',N'-dimethylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[5-[(dimethylamino)methylamino]-1-benzofuran-2-yl]phenyl]-N',N'-dimethylmethanediamine?
The IUPAC name of N-[4-[5-[(dimethylamino)methylamino]-1-benzofuran-2-yl]phenyl]-N',N'-dimethylmethanediamine (CID 3010567) is N-[4-[5-[(dimethylamino)methylamino]-1-benzofuran-2-yl]phenyl]-N',N'-dimethylmethanediamine.
What is the SMILES notation for N-[4-[5-[(dimethylamino)methylamino]-1-benzofuran-2-yl]phenyl]-N',N'-dimethylmethanediamine?
The canonical SMILES for N-[4-[5-[(dimethylamino)methylamino]-1-benzofuran-2-yl]phenyl]-N',N'-dimethylmethanediamine is CN(C)CNc1ccc(-c2cc3cc(NCN(C)C)ccc3o2)cc1.
What is the InChIKey of N-[4-[5-[(dimethylamino)methylamino]-1-benzofuran-2-yl]phenyl]-N',N'-dimethylmethanediamine?
The InChIKey is OMBMWLJOABAXKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N4O/c1-23(2)13-21-17-7-5-15(6-8-17)20-12-16-11-18(22-14-24(3)4)9-10-19(16)25-20/h5-12,21-22H,13-14H2,1-4H3.
What are the key properties of N-[4-[5-[(dimethylamino)methylamino]-1-benzofuran-2-yl]phenyl]-N',N'-dimethylmethanediamine?
N-[4-[5-[(dimethylamino)methylamino]-1-benzofuran-2-yl]phenyl]-N',N'-dimethylmethanediamine has a molecular weight of 338.46 g/mol, XLogP of 3.96, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[5-[(dimethylamino)methylamino]-1-benzofuran-2-yl]phenyl]-N',N'-dimethylmethanediamine is sourced from PubChem (CID 3010567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).