C8H12N2S3 — CID 30106148
5,5-diethyl-1,3-diazinane-2,4,6-trithione (PubChem CID 30106148) has the molecular formula C8H12N2S3 and a molecular weight of 232.40 g/mol. Its IUPAC name is 5,5-diethyl-1,3-diazinane-2,4,6-trithione.
| Compound Name | 5,5-diethyl-1,3-diazinane-2,4,6-trithione |
|---|---|
| PubChem CID | 30106148 |
| Molecular Formula | C8H12N2S3 |
| Molecular Weight | 232.40 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | 5,5-diethyl-1,3-diazinane-2,4,6-trithione |
| SMILES | CCC1(CC)C(=S)NC(=S)NC1=S |
| InChI | InChI=1S/C8H12N2S3/c1-3-8(4-2)5(11)9-7(13)10-6(8)12/h3-4H2,1-2H3,(H2,9,10,11,12,13) |
| InChIKey | XSVFFAKRLDPDFQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|