About 1-(4-imidazol-1-yl-6-methoxy-1,3,5-triazin-2-yl)azepane
1-(4-imidazol-1-yl-6-methoxy-1,3,5-triazin-2-yl)azepane (PubChem CID 30106396) has the molecular formula C13H18N6O
and a molecular weight of 274.33 g/mol. Its IUPAC name is 1-(4-imidazol-1-yl-6-methoxy-1,3,5-triazin-2-yl)azepane.
Molecular Properties
| Compound Name | 1-(4-imidazol-1-yl-6-methoxy-1,3,5-triazin-2-yl)azepane |
| PubChem CID | 30106396 |
| Molecular Formula | C13H18N6O |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 1-(4-imidazol-1-yl-6-methoxy-1,3,5-triazin-2-yl)azepane |
| SMILES | COc1nc(N2CCCCCC2)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C13H18N6O/c1-20-13-16-11(18-7-4-2-3-5-8-18)15-12(17-13)19-9-6-14-10-19/h6,9-10H,2-5,7-8H2,1H3 |
| InChIKey | OIQNRJIQZXMISN-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-(4-imidazol-1-yl-6-methoxy-1,3,5-triazin-2-yl)azepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-imidazol-1-yl-6-methoxy-1,3,5-triazin-2-yl)azepane?
The IUPAC name of 1-(4-imidazol-1-yl-6-methoxy-1,3,5-triazin-2-yl)azepane (CID 30106396) is 1-(4-imidazol-1-yl-6-methoxy-1,3,5-triazin-2-yl)azepane.
What is the SMILES notation for 1-(4-imidazol-1-yl-6-methoxy-1,3,5-triazin-2-yl)azepane?
The canonical SMILES for 1-(4-imidazol-1-yl-6-methoxy-1,3,5-triazin-2-yl)azepane is COc1nc(N2CCCCCC2)nc(-n2ccnc2)n1.
What is the InChIKey of 1-(4-imidazol-1-yl-6-methoxy-1,3,5-triazin-2-yl)azepane?
The InChIKey is OIQNRJIQZXMISN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N6O/c1-20-13-16-11(18-7-4-2-3-5-8-18)15-12(17-13)19-9-6-14-10-19/h6,9-10H,2-5,7-8H2,1H3.
What are the key properties of 1-(4-imidazol-1-yl-6-methoxy-1,3,5-triazin-2-yl)azepane?
1-(4-imidazol-1-yl-6-methoxy-1,3,5-triazin-2-yl)azepane has a molecular weight of 274.33 g/mol, XLogP of 1.45, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-imidazol-1-yl-6-methoxy-1,3,5-triazin-2-yl)azepane is sourced from PubChem (CID 30106396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).