C18H21N5O2S3 — CID 30108495
N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 30108495) has the molecular formula C18H21N5O2S3 and a molecular weight of 435.60 g/mol. Its IUPAC name is N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 30108495 |
| Molecular Formula | C18H21N5O2S3 |
| Molecular Weight | 435.60 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | CCc1ccc(-c2csc(NC(=O)CSc3nnc(NCCOC)s3)n2)cc1 |
| InChI | InChI=1S/C18H21N5O2S3/c1-3-12-4-6-13(7-5-12)14-10-26-17(20-14)21-15(24)11-27-18-23-22-16(28-18)19-8-9-25-2/h4-7,10H,3,8-9,11H2,1-2H3,(H,19,22)(H,20,21,24) |
| InChIKey | WAGRCAVISUJRNA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.60 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|