C30H33N3 — CID 3010984
6-[(2R)-2-[1-(4-methylcyclohexyl)-3,4-dihydroisoquinolin-7-yl]cyclopropyl]naphthalene-2-carboximidamide (PubChem CID 3010984) has the molecular formula C30H33N3 and a molecular weight of 435.62 g/mol. Its IUPAC name is 6-[(2R)-2-[1-(4-methylcyclohexyl)-3,4-dihydroisoquinolin-7-yl]cyclopropyl]naphthalene-2-carboximidamide.
| Compound Name | 6-[(2R)-2-[1-(4-methylcyclohexyl)-3,4-dihydroisoquinolin-7-yl]cyclopropyl]naphthalene-2-carboximidamide |
|---|---|
| PubChem CID | 3010984 |
| Molecular Formula | C30H33N3 |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.27 |
| IUPAC Name | 6-[(2R)-2-[1-(4-methylcyclohexyl)-3,4-dihydroisoquinolin-7-yl]cyclopropyl]naphthalene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2cc(C3C[C@H]3c3ccc4c(c3)C(C3CCC(C)CC3)=NCC4)ccc2c1 |
| InChI | InChI=1S/C30H33N3/c1-18-2-4-20(5-3-18)29-28-16-24(9-6-19(28)12-13-33-29)27-17-26(27)23-10-7-22-15-25(30(31)32)11-8-21(22)14-23/h6-11,14-16,18,20,26-27H,2-5,12-13,17H2,1H3,(H3,31,32)/t18?,20?,26?,27-/m0/s1 |
| InChIKey | LPWCQZXVCAEKJG-BCGCTUHLSA-N |
| XLogP | 6.57 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|