C34H38O6 — CID 3011252
(2R,3S,4S,5R)-1,2,5,6-tetrakis(phenylmethoxy)hexane-3,4-diol (PubChem CID 3011252) has the molecular formula C34H38O6 and a molecular weight of 542.67 g/mol. Its IUPAC name is (2R,3S,4S,5R)-1,2,5,6-tetrakis(phenylmethoxy)hexane-3,4-diol.
| Compound Name | (2R,3S,4S,5R)-1,2,5,6-tetrakis(phenylmethoxy)hexane-3,4-diol |
|---|---|
| PubChem CID | 3011252 |
| Molecular Formula | C34H38O6 |
| Molecular Weight | 542.67 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | (2R,3S,4S,5R)-1,2,5,6-tetrakis(phenylmethoxy)hexane-3,4-diol |
| SMILES | O[C@@H]([C@H](O)[C@@H](COCc1ccccc1)OCc1ccccc1)[C@@H](COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C34H38O6/c35-33(31(39-23-29-17-9-3-10-18-29)25-37-21-27-13-5-1-6-14-27)34(36)32(40-24-30-19-11-4-12-20-30)26-38-22-28-15-7-2-8-16-28/h1-20,31-36H,21-26H2/t31-,32-,33-,34-/m1/s1 |
| InChIKey | KBMAJZXSAFWWNW-YFRBGRBWSA-N |
| XLogP | 5.31 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.67 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |