C38H34F12O6 — CID 3011254
(2R,3S,4S,5R)-1,2,5,6-tetrakis[[4-(trifluoromethyl)phenyl]methoxy]hexane-3,4-diol (PubChem CID 3011254) has the molecular formula C38H34F12O6 and a molecular weight of 814.66 g/mol. Its IUPAC name is (2R,3S,4S,5R)-1,2,5,6-tetrakis[[4-(trifluoromethyl)phenyl]methoxy]hexane-3,4-diol.
| Compound Name | (2R,3S,4S,5R)-1,2,5,6-tetrakis[[4-(trifluoromethyl)phenyl]methoxy]hexane-3,4-diol |
|---|---|
| PubChem CID | 3011254 |
| Molecular Formula | C38H34F12O6 |
| Molecular Weight | 814.66 g/mol |
| Exact Mass | 814.22 |
| IUPAC Name | (2R,3S,4S,5R)-1,2,5,6-tetrakis[[4-(trifluoromethyl)phenyl]methoxy]hexane-3,4-diol |
| SMILES | O[C@@H]([C@H](O)[C@@H](COCc1ccc(C(F)(F)F)cc1)OCc1ccc(C(F)(F)F)cc1)[C@@H](COCc1ccc(C(F)(F)F)cc1)OCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C38H34F12O6/c39-35(40,41)27-9-1-23(2-10-27)17-53-21-31(55-19-25-5-13-29(14-6-25)37(45,46)47)33(51)34(52)32(56-20-26-7-15-30(16-8-26)38(48,49)50)22-54-18-24-3-11-28(12-4-24)36(42,43)44/h1-16,31-34,51-52H,17-22H2/t31-,32-,33-,34-/m1/s1 |
| InChIKey | FYKYGZKLICONGQ-YFRBGRBWSA-N |
| XLogP | 9.39 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.66 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |