C38H34N4O6 — CID 3011256
4-[[(2R,3S,4S,5R)-2,5,6-tris[(4-cyanophenyl)methoxy]-3,4-dihydroxyhexoxy]methyl]benzonitrile (PubChem CID 3011256) has the molecular formula C38H34N4O6 and a molecular weight of 642.71 g/mol. Its IUPAC name is 4-[[(2R,3S,4S,5R)-2,5,6-tris[(4-cyanophenyl)methoxy]-3,4-dihydroxyhexoxy]methyl]benzonitrile.
| Compound Name | 4-[[(2R,3S,4S,5R)-2,5,6-tris[(4-cyanophenyl)methoxy]-3,4-dihydroxyhexoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 3011256 |
| Molecular Formula | C38H34N4O6 |
| Molecular Weight | 642.71 g/mol |
| Exact Mass | 642.25 |
| IUPAC Name | 4-[[(2R,3S,4S,5R)-2,5,6-tris[(4-cyanophenyl)methoxy]-3,4-dihydroxyhexoxy]methyl]benzonitrile |
| SMILES | N#Cc1ccc(COC[C@@H](OCc2ccc(C#N)cc2)[C@@H](O)[C@H](O)[C@@H](COCc2ccc(C#N)cc2)OCc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C38H34N4O6/c39-17-27-1-9-31(10-2-27)21-45-25-35(47-23-33-13-5-29(19-41)6-14-33)37(43)38(44)36(48-24-34-15-7-30(20-42)8-16-34)26-46-22-32-11-3-28(18-40)4-12-32/h1-16,35-38,43-44H,21-26H2/t35-,36-,37-,38-/m1/s1 |
| InChIKey | GMRLNLALZAJUCH-SIMZDOAPSA-N |
| XLogP | 4.80 |
| TPSA | 172.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.71 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |