C34H34F4O6 — CID 3011262
(2R,3S,4S,5R)-2,5-bis[(2,6-difluorophenyl)methoxy]-1,6-bis(phenylmethoxy)hexane-3,4-diol (PubChem CID 3011262) has the molecular formula C34H34F4O6 and a molecular weight of 614.63 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2,5-bis[(2,6-difluorophenyl)methoxy]-1,6-bis(phenylmethoxy)hexane-3,4-diol.
| Compound Name | (2R,3S,4S,5R)-2,5-bis[(2,6-difluorophenyl)methoxy]-1,6-bis(phenylmethoxy)hexane-3,4-diol |
|---|---|
| PubChem CID | 3011262 |
| Molecular Formula | C34H34F4O6 |
| Molecular Weight | 614.63 g/mol |
| Exact Mass | 614.23 |
| IUPAC Name | (2R,3S,4S,5R)-2,5-bis[(2,6-difluorophenyl)methoxy]-1,6-bis(phenylmethoxy)hexane-3,4-diol |
| SMILES | O[C@@H]([C@H](O)[C@@H](COCc1ccccc1)OCc1c(F)cccc1F)[C@@H](COCc1ccccc1)OCc1c(F)cccc1F |
| InChI | InChI=1S/C34H34F4O6/c35-27-13-7-14-28(36)25(27)19-43-31(21-41-17-23-9-3-1-4-10-23)33(39)34(40)32(22-42-18-24-11-5-2-6-12-24)44-20-26-29(37)15-8-16-30(26)38/h1-16,31-34,39-40H,17-22H2/t31-,32-,33-,34-/m1/s1 |
| InChIKey | UXAVDIADWKFOOR-YFRBGRBWSA-N |
| XLogP | 5.87 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.63 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |