C36H38O10 — CID 3011268
4-[[(2R,3S,4S,5R)-5-[(4-carboxyphenyl)methoxy]-3,4-dihydroxy-1,6-bis(phenylmethoxy)hexan-2-yl]oxymethyl]benzoic acid (PubChem CID 3011268) has the molecular formula C36H38O10 and a molecular weight of 630.69 g/mol. Its IUPAC name is 4-[[(2R,3S,4S,5R)-5-[(4-carboxyphenyl)methoxy]-3,4-dihydroxy-1,6-bis(phenylmethoxy)hexan-2-yl]oxymethyl]benzoic acid.
| Compound Name | 4-[[(2R,3S,4S,5R)-5-[(4-carboxyphenyl)methoxy]-3,4-dihydroxy-1,6-bis(phenylmethoxy)hexan-2-yl]oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 3011268 |
| Molecular Formula | C36H38O10 |
| Molecular Weight | 630.69 g/mol |
| Exact Mass | 630.25 |
| IUPAC Name | 4-[[(2R,3S,4S,5R)-5-[(4-carboxyphenyl)methoxy]-3,4-dihydroxy-1,6-bis(phenylmethoxy)hexan-2-yl]oxymethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CO[C@H](COCc2ccccc2)[C@@H](O)[C@H](O)[C@@H](COCc2ccccc2)OCc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C36H38O10/c37-33(31(23-43-19-25-7-3-1-4-8-25)45-21-27-11-15-29(16-12-27)35(39)40)34(38)32(24-44-20-26-9-5-2-6-10-26)46-22-28-13-17-30(18-14-28)36(41)42/h1-18,31-34,37-38H,19-24H2,(H,39,40)(H,41,42)/t31-,32-,33-,34-/m1/s1 |
| InChIKey | ILKMSPMPYBCBOV-YFRBGRBWSA-N |
| XLogP | 4.71 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.69 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |