C34H36F2O6 — CID 3011274
(2R,3S,4S,5R)-1,6-bis[(2-fluorophenyl)methoxy]-2,5-bis(phenylmethoxy)hexane-3,4-diol (PubChem CID 3011274) has the molecular formula C34H36F2O6 and a molecular weight of 578.65 g/mol. Its IUPAC name is (2R,3S,4S,5R)-1,6-bis[(2-fluorophenyl)methoxy]-2,5-bis(phenylmethoxy)hexane-3,4-diol.
| Compound Name | (2R,3S,4S,5R)-1,6-bis[(2-fluorophenyl)methoxy]-2,5-bis(phenylmethoxy)hexane-3,4-diol |
|---|---|
| PubChem CID | 3011274 |
| Molecular Formula | C34H36F2O6 |
| Molecular Weight | 578.65 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | (2R,3S,4S,5R)-1,6-bis[(2-fluorophenyl)methoxy]-2,5-bis(phenylmethoxy)hexane-3,4-diol |
| SMILES | O[C@@H]([C@H](O)[C@@H](COCc1ccccc1F)OCc1ccccc1)[C@@H](COCc1ccccc1F)OCc1ccccc1 |
| InChI | InChI=1S/C34H36F2O6/c35-29-17-9-7-15-27(29)21-39-23-31(41-19-25-11-3-1-4-12-25)33(37)34(38)32(42-20-26-13-5-2-6-14-26)24-40-22-28-16-8-10-18-30(28)36/h1-18,31-34,37-38H,19-24H2/t31-,32-,33-,34-/m1/s1 |
| InChIKey | AIHFOFYSLOCLJP-YFRBGRBWSA-N |
| XLogP | 5.59 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.65 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |