C38H42O10 — CID 3011282
methyl 4-[[(2R,3S,4S,5R)-3,4-dihydroxy-6-[(4-methoxycarbonylphenyl)methoxy]-2,5-bis(phenylmethoxy)hexoxy]methyl]benzoate (PubChem CID 3011282) has the molecular formula C38H42O10 and a molecular weight of 658.74 g/mol. Its IUPAC name is methyl 4-[[(2R,3S,4S,5R)-3,4-dihydroxy-6-[(4-methoxycarbonylphenyl)methoxy]-2,5-bis(phenylmethoxy)hexoxy]methyl]benzoate.
| Compound Name | methyl 4-[[(2R,3S,4S,5R)-3,4-dihydroxy-6-[(4-methoxycarbonylphenyl)methoxy]-2,5-bis(phenylmethoxy)hexoxy]methyl]benzoate |
|---|---|
| PubChem CID | 3011282 |
| Molecular Formula | C38H42O10 |
| Molecular Weight | 658.74 g/mol |
| Exact Mass | 658.28 |
| IUPAC Name | methyl 4-[[(2R,3S,4S,5R)-3,4-dihydroxy-6-[(4-methoxycarbonylphenyl)methoxy]-2,5-bis(phenylmethoxy)hexoxy]methyl]benzoate |
| SMILES | COC(=O)c1ccc(COC[C@@H](OCc2ccccc2)[C@@H](O)[C@H](O)[C@@H](COCc2ccc(C(=O)OC)cc2)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C38H42O10/c1-43-37(41)31-17-13-29(14-18-31)21-45-25-33(47-23-27-9-5-3-6-10-27)35(39)36(40)34(48-24-28-11-7-4-8-12-28)26-46-22-30-15-19-32(20-16-30)38(42)44-2/h3-20,33-36,39-40H,21-26H2,1-2H3/t33-,34-,35-,36-/m1/s1 |
| InChIKey | KCVGKHMVTMBGSD-MGXDLYCJSA-N |
| XLogP | 4.89 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.74 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |