C36H40F2O6 — CID 3011285
(2R,3S,4S,5R)-1,6-bis[(2-fluorophenyl)methoxy]-2,5-bis[(2-methylphenyl)methoxy]hexane-3,4-diol (PubChem CID 3011285) has the molecular formula C36H40F2O6 and a molecular weight of 606.71 g/mol. Its IUPAC name is (2R,3S,4S,5R)-1,6-bis[(2-fluorophenyl)methoxy]-2,5-bis[(2-methylphenyl)methoxy]hexane-3,4-diol.
| Compound Name | (2R,3S,4S,5R)-1,6-bis[(2-fluorophenyl)methoxy]-2,5-bis[(2-methylphenyl)methoxy]hexane-3,4-diol |
|---|---|
| PubChem CID | 3011285 |
| Molecular Formula | C36H40F2O6 |
| Molecular Weight | 606.71 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | (2R,3S,4S,5R)-1,6-bis[(2-fluorophenyl)methoxy]-2,5-bis[(2-methylphenyl)methoxy]hexane-3,4-diol |
| SMILES | Cc1ccccc1CO[C@H](COCc1ccccc1F)[C@@H](O)[C@H](O)[C@@H](COCc1ccccc1F)OCc1ccccc1C |
| InChI | InChI=1S/C36H40F2O6/c1-25-11-3-5-13-27(25)21-43-33(23-41-19-29-15-7-9-17-31(29)37)35(39)36(40)34(44-22-28-14-6-4-12-26(28)2)24-42-20-30-16-8-10-18-32(30)38/h3-18,33-36,39-40H,19-24H2,1-2H3/t33-,34-,35-,36-/m1/s1 |
| InChIKey | GRBZOMGFLUVFQC-MGXDLYCJSA-N |
| XLogP | 6.21 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.71 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |