C32H34O4 — CID 3011293
(2R,3S,4S,5R)-1,6-diphenyl-2,5-bis(phenylmethoxy)hexane-3,4-diol (PubChem CID 3011293) has the molecular formula C32H34O4 and a molecular weight of 482.62 g/mol. Its IUPAC name is (2R,3S,4S,5R)-1,6-diphenyl-2,5-bis(phenylmethoxy)hexane-3,4-diol.
| Compound Name | (2R,3S,4S,5R)-1,6-diphenyl-2,5-bis(phenylmethoxy)hexane-3,4-diol |
|---|---|
| PubChem CID | 3011293 |
| Molecular Formula | C32H34O4 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | (2R,3S,4S,5R)-1,6-diphenyl-2,5-bis(phenylmethoxy)hexane-3,4-diol |
| SMILES | O[C@@H]([C@H](O)[C@@H](Cc1ccccc1)OCc1ccccc1)[C@@H](Cc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C32H34O4/c33-31(29(21-25-13-5-1-6-14-25)35-23-27-17-9-3-10-18-27)32(34)30(22-26-15-7-2-8-16-26)36-24-28-19-11-4-12-20-28/h1-20,29-34H,21-24H2/t29-,30-,31-,32-/m1/s1 |
| InChIKey | UCGMCPKWNDAGPA-SEVDZJIVSA-N |
| XLogP | 5.36 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |