C28H26Cl2FN3 — CID 3011384
1-[[1,5-bis(4-chlorophenyl)-2-methylpyrrol-3-yl]methyl]-4-(4-fluorophenyl)piperazine (PubChem CID 3011384) has the molecular formula C28H26Cl2FN3 and a molecular weight of 494.44 g/mol. Its IUPAC name is 1-[[1,5-bis(4-chlorophenyl)-2-methylpyrrol-3-yl]methyl]-4-(4-fluorophenyl)piperazine.
| Compound Name | 1-[[1,5-bis(4-chlorophenyl)-2-methylpyrrol-3-yl]methyl]-4-(4-fluorophenyl)piperazine |
|---|---|
| PubChem CID | 3011384 |
| Molecular Formula | C28H26Cl2FN3 |
| Molecular Weight | 494.44 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 1-[[1,5-bis(4-chlorophenyl)-2-methylpyrrol-3-yl]methyl]-4-(4-fluorophenyl)piperazine |
| SMILES | Cc1c(CN2CCN(c3ccc(F)cc3)CC2)cc(-c2ccc(Cl)cc2)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H26Cl2FN3/c1-20-22(19-32-14-16-33(17-15-32)26-12-8-25(31)9-13-26)18-28(21-2-4-23(29)5-3-21)34(20)27-10-6-24(30)7-11-27/h2-13,18H,14-17,19H2,1H3 |
| InChIKey | LQBJHMJPGICZCY-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.44 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|