C18H18O5 — CID 3011493
(2S,3S,4R,5R)-2-(9H-fluoren-9-yloxy)oxane-3,4,5-triol (PubChem CID 3011493) has the molecular formula C18H18O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-(9H-fluoren-9-yloxy)oxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5R)-2-(9H-fluoren-9-yloxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 3011493 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (2S,3S,4R,5R)-2-(9H-fluoren-9-yloxy)oxane-3,4,5-triol |
| SMILES | O[C@@H]1[C@H](OC2c3ccccc3-c3ccccc32)OC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H18O5/c19-14-9-22-18(16(21)15(14)20)23-17-12-7-3-1-5-10(12)11-6-2-4-8-13(11)17/h1-8,14-21H,9H2/t14-,15-,16+,18+/m1/s1 |
| InChIKey | LHRCUGCREPSUSR-CBZIJGRNSA-N |
| XLogP | 1.21 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |