About cis-ethyl (1R,2R)-2-fluoro-2-phenylcyclopropane-1-carboxylate
cis-ethyl (1R,2R)-2-fluoro-2-phenylcyclopropane-1-carboxylate (PubChem CID 3011497) has the molecular formula C12H13FO2
and a molecular weight of 208.23 g/mol. Its IUPAC name is cis-ethyl (1R,2R)-2-fluoro-2-phenylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | cis-ethyl (1R,2R)-2-fluoro-2-phenylcyclopropane-1-carboxylate |
| PubChem CID | 3011497 |
| Molecular Formula | C12H13FO2 |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | cis-ethyl (1R,2R)-2-fluoro-2-phenylcyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@]1(F)c1ccccc1 |
| InChI | InChI=1S/C12H13FO2/c1-2-15-11(14)10-8-12(10,13)9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3/t10-,12+/m1/s1 |
| InChIKey | QTSSAQZLIITOFS-PWSUYJOCSA-N |
| XLogP | 2.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cis-ethyl (1R,2R)-2-fluoro-2-phenylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-ethyl (1R,2R)-2-fluoro-2-phenylcyclopropane-1-carboxylate?
The IUPAC name of cis-ethyl (1R,2R)-2-fluoro-2-phenylcyclopropane-1-carboxylate (CID 3011497) is cis-ethyl (1R,2R)-2-fluoro-2-phenylcyclopropane-1-carboxylate.
What is the SMILES notation for cis-ethyl (1R,2R)-2-fluoro-2-phenylcyclopropane-1-carboxylate?
The canonical SMILES for cis-ethyl (1R,2R)-2-fluoro-2-phenylcyclopropane-1-carboxylate is CCOC(=O)[C@H]1C[C@]1(F)c1ccccc1.
What is the InChIKey of cis-ethyl (1R,2R)-2-fluoro-2-phenylcyclopropane-1-carboxylate?
The InChIKey is QTSSAQZLIITOFS-PWSUYJOCSA-N. The full InChI is InChI=1S/C12H13FO2/c1-2-15-11(14)10-8-12(10,13)9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3/t10-,12+/m1/s1.
What are the key properties of cis-ethyl (1R,2R)-2-fluoro-2-phenylcyclopropane-1-carboxylate?
cis-ethyl (1R,2R)-2-fluoro-2-phenylcyclopropane-1-carboxylate has a molecular weight of 208.23 g/mol, XLogP of 2.43, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-ethyl (1R,2R)-2-fluoro-2-phenylcyclopropane-1-carboxylate is sourced from PubChem (CID 3011497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).