About 4-amino-1-[[(1S,2S)-1-fluoro-2-(hydroxymethyl)cyclopropyl]methyl]pyrimidin-2-one
4-amino-1-[[(1S,2S)-1-fluoro-2-(hydroxymethyl)cyclopropyl]methyl]pyrimidin-2-one (PubChem CID 3011519) has the molecular formula C9H12FN3O2
and a molecular weight of 213.21 g/mol. Its IUPAC name is 4-amino-1-[[(1S,2S)-1-fluoro-2-(hydroxymethyl)cyclopropyl]methyl]pyrimidin-2-one.
Molecular Properties
| Compound Name | 4-amino-1-[[(1S,2S)-1-fluoro-2-(hydroxymethyl)cyclopropyl]methyl]pyrimidin-2-one |
| PubChem CID | 3011519 |
| Molecular Formula | C9H12FN3O2 |
| Molecular Weight | 213.21 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 4-amino-1-[[(1S,2S)-1-fluoro-2-(hydroxymethyl)cyclopropyl]methyl]pyrimidin-2-one |
| SMILES | Nc1ccn(C[C@]2(F)C[C@H]2CO)c(=O)n1 |
| InChI | InChI=1S/C9H12FN3O2/c10-9(3-6(9)4-14)5-13-2-1-7(11)12-8(13)15/h1-2,6,14H,3-5H2,(H2,11,12,15)/t6-,9+/m0/s1 |
| InChIKey | FMTDRDHBJYPERN-IMTBSYHQSA-N |
| XLogP | -0.45 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.21 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-1-[[(1S,2S)-1-fluoro-2-(hydroxymethyl)cyclopropyl]methyl]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-[[(1S,2S)-1-fluoro-2-(hydroxymethyl)cyclopropyl]methyl]pyrimidin-2-one?
The IUPAC name of 4-amino-1-[[(1S,2S)-1-fluoro-2-(hydroxymethyl)cyclopropyl]methyl]pyrimidin-2-one (CID 3011519) is 4-amino-1-[[(1S,2S)-1-fluoro-2-(hydroxymethyl)cyclopropyl]methyl]pyrimidin-2-one.
What is the SMILES notation for 4-amino-1-[[(1S,2S)-1-fluoro-2-(hydroxymethyl)cyclopropyl]methyl]pyrimidin-2-one?
The canonical SMILES for 4-amino-1-[[(1S,2S)-1-fluoro-2-(hydroxymethyl)cyclopropyl]methyl]pyrimidin-2-one is Nc1ccn(C[C@]2(F)C[C@H]2CO)c(=O)n1.
What is the InChIKey of 4-amino-1-[[(1S,2S)-1-fluoro-2-(hydroxymethyl)cyclopropyl]methyl]pyrimidin-2-one?
The InChIKey is FMTDRDHBJYPERN-IMTBSYHQSA-N. The full InChI is InChI=1S/C9H12FN3O2/c10-9(3-6(9)4-14)5-13-2-1-7(11)12-8(13)15/h1-2,6,14H,3-5H2,(H2,11,12,15)/t6-,9+/m0/s1.
What are the key properties of 4-amino-1-[[(1S,2S)-1-fluoro-2-(hydroxymethyl)cyclopropyl]methyl]pyrimidin-2-one?
4-amino-1-[[(1S,2S)-1-fluoro-2-(hydroxymethyl)cyclopropyl]methyl]pyrimidin-2-one has a molecular weight of 213.21 g/mol, XLogP of -0.45, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-[[(1S,2S)-1-fluoro-2-(hydroxymethyl)cyclopropyl]methyl]pyrimidin-2-one is sourced from PubChem (CID 3011519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).