C31H48O3 — CID 3011625
(2R,3R,5R,10S,15S,17R)-15-methoxy-4,4,10,12-tetramethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,3,5,6,7,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-2,3-diol (PubChem CID 3011625) has the molecular formula C31H48O3 and a molecular weight of 468.72 g/mol. Its IUPAC name is (2R,3R,5R,10S,15S,17R)-15-methoxy-4,4,10,12-tetramethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,3,5,6,7,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-2,3-diol.
| Compound Name | (2R,3R,5R,10S,15S,17R)-15-methoxy-4,4,10,12-tetramethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,3,5,6,7,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-2,3-diol |
|---|---|
| PubChem CID | 3011625 |
| Molecular Formula | C31H48O3 |
| Molecular Weight | 468.72 g/mol |
| Exact Mass | 468.36 |
| IUPAC Name | (2R,3R,5R,10S,15S,17R)-15-methoxy-4,4,10,12-tetramethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,3,5,6,7,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-2,3-diol |
| SMILES | C=C(CC[C@@H](C)[C@H]1C[C@H](OC)c2c3c(cc(C)c21)[C@@]1(C)C[C@@H](O)[C@H](O)C(C)(C)[C@@H]1CC3)C(C)C |
| InChI | InChI=1S/C31H48O3/c1-17(2)18(3)10-11-19(4)22-15-25(34-9)28-21-12-13-26-30(6,7)29(33)24(32)16-31(26,8)23(21)14-20(5)27(22)28/h14,17,19,22,24-26,29,32-33H,3,10-13,15-16H2,1-2,4-9H3/t19-,22-,24-,25+,26+,29+,31-/m1/s1 |
| InChIKey | BXCRKUNRRNCNNC-WEKIXPIHSA-N |
| XLogP | 6.77 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.72 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|