About methyl 1-(7-acetamido-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate
methyl 1-(7-acetamido-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 3011654) has the molecular formula C25H18N4O5
and a molecular weight of 454.44 g/mol. Its IUPAC name is methyl 1-(7-acetamido-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 1-(7-acetamido-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate |
| PubChem CID | 3011654 |
| Molecular Formula | C25H18N4O5 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | methyl 1-(7-acetamido-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc3c(n2)C(=O)C(NC(C)=O)=CC3=O)c2[nH]c3ccccc3c2c1C |
| InChI | InChI=1S/C25H18N4O5/c1-11-19-13-6-4-5-7-15(13)27-23(19)22(29-20(11)25(33)34-3)16-9-8-14-18(31)10-17(26-12(2)30)24(32)21(14)28-16/h4-10,27H,1-3H3,(H,26,30) |
| InChIKey | JNJRCOSFPJAESW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-(7-acetamido-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(7-acetamido-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate?
The IUPAC name of methyl 1-(7-acetamido-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate (CID 3011654) is methyl 1-(7-acetamido-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate.
What is the SMILES notation for methyl 1-(7-acetamido-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate?
The canonical SMILES for methyl 1-(7-acetamido-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate is COC(=O)c1nc(-c2ccc3c(n2)C(=O)C(NC(C)=O)=CC3=O)c2[nH]c3ccccc3c2c1C.
What is the InChIKey of methyl 1-(7-acetamido-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate?
The InChIKey is JNJRCOSFPJAESW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H18N4O5/c1-11-19-13-6-4-5-7-15(13)27-23(19)22(29-20(11)25(33)34-3)16-9-8-14-18(31)10-17(26-12(2)30)24(32)21(14)28-16/h4-10,27H,1-3H3,(H,26,30).
What are the key properties of methyl 1-(7-acetamido-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate?
methyl 1-(7-acetamido-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate has a molecular weight of 454.44 g/mol, XLogP of 3.27, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(7-acetamido-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate is sourced from PubChem (CID 3011654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).