C25H27N7O2S — CID 3011775
(2S)-2,6-diamino-N-[3-[6-(1,3-benzothiazol-2-ylcarbamoylamino)-3-pyridinyl]phenyl]hexanamide (PubChem CID 3011775) has the molecular formula C25H27N7O2S and a molecular weight of 489.61 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[3-[6-(1,3-benzothiazol-2-ylcarbamoylamino)-3-pyridinyl]phenyl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[3-[6-(1,3-benzothiazol-2-ylcarbamoylamino)-3-pyridinyl]phenyl]hexanamide |
|---|---|
| PubChem CID | 3011775 |
| Molecular Formula | C25H27N7O2S |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | (2S)-2,6-diamino-N-[3-[6-(1,3-benzothiazol-2-ylcarbamoylamino)-3-pyridinyl]phenyl]hexanamide |
| SMILES | NCCCC[C@H](N)C(=O)Nc1cccc(-c2ccc(NC(=O)Nc3nc4ccccc4s3)nc2)c1 |
| InChI | InChI=1S/C25H27N7O2S/c26-13-4-3-8-19(27)23(33)29-18-7-5-6-16(14-18)17-11-12-22(28-15-17)31-24(34)32-25-30-20-9-1-2-10-21(20)35-25/h1-2,5-7,9-12,14-15,19H,3-4,8,13,26-27H2,(H,29,33)(H2,28,30,31,32,34)/t19-/m0/s1 |
| InChIKey | TWSPGUBATYACRD-IBGZPJMESA-N |
| XLogP | 4.40 |
| TPSA | 148.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|