C21H17NO6 — CID 3012085
methyl 4-(5-benzyl-[1,3]dioxolo[4,5-f]indol-6-yl)-2,4-dioxobutanoate (PubChem CID 3012085) has the molecular formula C21H17NO6 and a molecular weight of 379.37 g/mol. Its IUPAC name is methyl 4-(5-benzyl-[1,3]dioxolo[4,5-f]indol-6-yl)-2,4-dioxobutanoate.
| Compound Name | methyl 4-(5-benzyl-[1,3]dioxolo[4,5-f]indol-6-yl)-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 3012085 |
| Molecular Formula | C21H17NO6 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | methyl 4-(5-benzyl-[1,3]dioxolo[4,5-f]indol-6-yl)-2,4-dioxobutanoate |
| SMILES | COC(=O)C(=O)CC(=O)c1cc2cc3c(cc2n1Cc1ccccc1)OCO3 |
| InChI | InChI=1S/C21H17NO6/c1-26-21(25)18(24)10-17(23)16-7-14-8-19-20(28-12-27-19)9-15(14)22(16)11-13-5-3-2-4-6-13/h2-9H,10-12H2,1H3 |
| InChIKey | WHLAGEUKIWEEAQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|