About (2R)-2-amino-2-(2,5-dichlorophenyl)propanenitrile
(2R)-2-amino-2-(2,5-dichlorophenyl)propanenitrile (PubChem CID 30123245) has the molecular formula C9H8Cl2N2
and a molecular weight of 215.08 g/mol. Its IUPAC name is (2R)-2-amino-2-(2,5-dichlorophenyl)propanenitrile.
Molecular Properties
| Compound Name | (2R)-2-amino-2-(2,5-dichlorophenyl)propanenitrile |
| PubChem CID | 30123245 |
| Molecular Formula | C9H8Cl2N2 |
| Molecular Weight | 215.08 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | (2R)-2-amino-2-(2,5-dichlorophenyl)propanenitrile |
| SMILES | C[C@](N)(C#N)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C9H8Cl2N2/c1-9(13,5-12)7-4-6(10)2-3-8(7)11/h2-4H,13H2,1H3/t9-/m0/s1 |
| InChIKey | DNXPBZXMGXUMET-VIFPVBQESA-N |
| XLogP | 2.69 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.08 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-amino-2-(2,5-dichlorophenyl)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-2-(2,5-dichlorophenyl)propanenitrile?
The IUPAC name of (2R)-2-amino-2-(2,5-dichlorophenyl)propanenitrile (CID 30123245) is (2R)-2-amino-2-(2,5-dichlorophenyl)propanenitrile.
What is the SMILES notation for (2R)-2-amino-2-(2,5-dichlorophenyl)propanenitrile?
The canonical SMILES for (2R)-2-amino-2-(2,5-dichlorophenyl)propanenitrile is C[C@](N)(C#N)c1cc(Cl)ccc1Cl.
What is the InChIKey of (2R)-2-amino-2-(2,5-dichlorophenyl)propanenitrile?
The InChIKey is DNXPBZXMGXUMET-VIFPVBQESA-N. The full InChI is InChI=1S/C9H8Cl2N2/c1-9(13,5-12)7-4-6(10)2-3-8(7)11/h2-4H,13H2,1H3/t9-/m0/s1.
What are the key properties of (2R)-2-amino-2-(2,5-dichlorophenyl)propanenitrile?
(2R)-2-amino-2-(2,5-dichlorophenyl)propanenitrile has a molecular weight of 215.08 g/mol, XLogP of 2.69, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-2-(2,5-dichlorophenyl)propanenitrile is sourced from PubChem (CID 30123245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).