C25H23N5O2S — CID 3012393
2-ethyl-9-methyl-13-[2-[4-(1,3-thiazol-4-yl)phenoxy]ethyl]-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one (PubChem CID 3012393) has the molecular formula C25H23N5O2S and a molecular weight of 457.56 g/mol. Its IUPAC name is 2-ethyl-9-methyl-13-[2-[4-(1,3-thiazol-4-yl)phenoxy]ethyl]-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one.
| Compound Name | 2-ethyl-9-methyl-13-[2-[4-(1,3-thiazol-4-yl)phenoxy]ethyl]-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one |
|---|---|
| PubChem CID | 3012393 |
| Molecular Formula | C25H23N5O2S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 2-ethyl-9-methyl-13-[2-[4-(1,3-thiazol-4-yl)phenoxy]ethyl]-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one |
| SMILES | CCN1c2ncc(CCOc3ccc(-c4cscn4)cc3)cc2C(=O)N(C)c2cccnc21 |
| InChI | InChI=1S/C25H23N5O2S/c1-3-30-23-20(25(31)29(2)22-5-4-11-26-24(22)30)13-17(14-27-23)10-12-32-19-8-6-18(7-9-19)21-15-33-16-28-21/h4-9,11,13-16H,3,10,12H2,1-2H3 |
| InChIKey | YMXJIXWVRCSXMC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |