About methyl 3-benzyl-6,7-difluoro-4-oxido-1-oxoquinoxalin-1-ium-2-carboxylate
methyl 3-benzyl-6,7-difluoro-4-oxido-1-oxoquinoxalin-1-ium-2-carboxylate (PubChem CID 3012523) has the molecular formula C17H12F2N2O4
and a molecular weight of 346.29 g/mol. Its IUPAC name is methyl 3-benzyl-6,7-difluoro-4-oxido-1-oxoquinoxalin-1-ium-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-benzyl-6,7-difluoro-4-oxido-1-oxoquinoxalin-1-ium-2-carboxylate |
| PubChem CID | 3012523 |
| Molecular Formula | C17H12F2N2O4 |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | methyl 3-benzyl-6,7-difluoro-4-oxido-1-oxoquinoxalin-1-ium-2-carboxylate |
| SMILES | COC(=O)c1c(Cc2ccccc2)n([O-])c2cc(F)c(F)cc2[n+]1=O |
| InChI | InChI=1S/C17H12F2N2O4/c1-25-17(22)16-15(7-10-5-3-2-4-6-10)20(23)13-8-11(18)12(19)9-14(13)21(16)24/h2-6,8-9H,7H2,1H3 |
| InChIKey | ULDLBTIOJPOLTE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 77.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-benzyl-6,7-difluoro-4-oxido-1-oxoquinoxalin-1-ium-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-benzyl-6,7-difluoro-4-oxido-1-oxoquinoxalin-1-ium-2-carboxylate?
The IUPAC name of methyl 3-benzyl-6,7-difluoro-4-oxido-1-oxoquinoxalin-1-ium-2-carboxylate (CID 3012523) is methyl 3-benzyl-6,7-difluoro-4-oxido-1-oxoquinoxalin-1-ium-2-carboxylate.
What is the SMILES notation for methyl 3-benzyl-6,7-difluoro-4-oxido-1-oxoquinoxalin-1-ium-2-carboxylate?
The canonical SMILES for methyl 3-benzyl-6,7-difluoro-4-oxido-1-oxoquinoxalin-1-ium-2-carboxylate is COC(=O)c1c(Cc2ccccc2)n([O-])c2cc(F)c(F)cc2[n+]1=O.
What is the InChIKey of methyl 3-benzyl-6,7-difluoro-4-oxido-1-oxoquinoxalin-1-ium-2-carboxylate?
The InChIKey is ULDLBTIOJPOLTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12F2N2O4/c1-25-17(22)16-15(7-10-5-3-2-4-6-10)20(23)13-8-11(18)12(19)9-14(13)21(16)24/h2-6,8-9H,7H2,1H3.
What are the key properties of methyl 3-benzyl-6,7-difluoro-4-oxido-1-oxoquinoxalin-1-ium-2-carboxylate?
methyl 3-benzyl-6,7-difluoro-4-oxido-1-oxoquinoxalin-1-ium-2-carboxylate has a molecular weight of 346.29 g/mol, XLogP of 2.56, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-benzyl-6,7-difluoro-4-oxido-1-oxoquinoxalin-1-ium-2-carboxylate is sourced from PubChem (CID 3012523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).