C19H23FN2O4S — CID 30126016
2-(4-fluorophenoxy)-N-[2-[4-(propan-2-ylsulfamoyl)phenyl]ethyl]acetamide (PubChem CID 30126016) has the molecular formula C19H23FN2O4S and a molecular weight of 394.47 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-N-[2-[4-(propan-2-ylsulfamoyl)phenyl]ethyl]acetamide.
| Compound Name | 2-(4-fluorophenoxy)-N-[2-[4-(propan-2-ylsulfamoyl)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 30126016 |
| Molecular Formula | C19H23FN2O4S |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 2-(4-fluorophenoxy)-N-[2-[4-(propan-2-ylsulfamoyl)phenyl]ethyl]acetamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(CCNC(=O)COc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H23FN2O4S/c1-14(2)22-27(24,25)18-9-3-15(4-10-18)11-12-21-19(23)13-26-17-7-5-16(20)6-8-17/h3-10,14,22H,11-13H2,1-2H3,(H,21,23) |
| InChIKey | GEQGJOFBMHJMBG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |