C18H27N3O5S — CID 30127580
N'-[(2R)-butan-2-yl]-N-[2-(4-morpholin-4-ylsulfonylphenyl)ethyl]oxamide (PubChem CID 30127580) has the molecular formula C18H27N3O5S and a molecular weight of 397.50 g/mol. Its IUPAC name is N'-[(2R)-butan-2-yl]-N-[2-(4-morpholin-4-ylsulfonylphenyl)ethyl]oxamide.
| Compound Name | N'-[(2R)-butan-2-yl]-N-[2-(4-morpholin-4-ylsulfonylphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 30127580 |
| Molecular Formula | C18H27N3O5S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | N'-[(2R)-butan-2-yl]-N-[2-(4-morpholin-4-ylsulfonylphenyl)ethyl]oxamide |
| SMILES | CC[C@@H](C)NC(=O)C(=O)NCCc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H27N3O5S/c1-3-14(2)20-18(23)17(22)19-9-8-15-4-6-16(7-5-15)27(24,25)21-10-12-26-13-11-21/h4-7,14H,3,8-13H2,1-2H3,(H,19,22)(H,20,23)/t14-/m1/s1 |
| InChIKey | CDBOEKXNMGXODQ-CQSZACIVSA-N |
| XLogP | 0.28 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|