C9H5BrCl2N4 — CID 30128
N-(4-bromophenyl)-4,6-dichloro-1,3,5-triazin-2-amine (PubChem CID 30128) has the molecular formula C9H5BrCl2N4 and a molecular weight of 319.98 g/mol. Its IUPAC name is N-(4-bromophenyl)-4,6-dichloro-1,3,5-triazin-2-amine.
| Compound Name | N-(4-bromophenyl)-4,6-dichloro-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 30128 |
| Molecular Formula | C9H5BrCl2N4 |
| Molecular Weight | 319.98 g/mol |
| Exact Mass | 317.91 |
| IUPAC Name | N-(4-bromophenyl)-4,6-dichloro-1,3,5-triazin-2-amine |
| SMILES | Clc1nc(Cl)nc(Nc2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C9H5BrCl2N4/c10-5-1-3-6(4-2-5)13-9-15-7(11)14-8(12)16-9/h1-4H,(H,13,14,15,16) |
| InChIKey | IWIXEPQRDKRMCA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.98 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |