C24H30N2O6S — CID 30128167
butyl 4-[[(2R)-1-(5-methoxy-2-methylphenyl)sulfonylpyrrolidine-2-carbonyl]amino]benzoate (PubChem CID 30128167) has the molecular formula C24H30N2O6S and a molecular weight of 474.58 g/mol. Its IUPAC name is butyl 4-[[(2R)-1-(5-methoxy-2-methylphenyl)sulfonylpyrrolidine-2-carbonyl]amino]benzoate.
| Compound Name | butyl 4-[[(2R)-1-(5-methoxy-2-methylphenyl)sulfonylpyrrolidine-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 30128167 |
| Molecular Formula | C24H30N2O6S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | butyl 4-[[(2R)-1-(5-methoxy-2-methylphenyl)sulfonylpyrrolidine-2-carbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)[C@H]2CCCN2S(=O)(=O)c2cc(OC)ccc2C)cc1 |
| InChI | InChI=1S/C24H30N2O6S/c1-4-5-15-32-24(28)18-9-11-19(12-10-18)25-23(27)21-7-6-14-26(21)33(29,30)22-16-20(31-3)13-8-17(22)2/h8-13,16,21H,4-7,14-15H2,1-3H3,(H,25,27)/t21-/m1/s1 |
| InChIKey | QLRGJQXXJKYVTP-OAQYLSRUSA-N |
| XLogP | 3.75 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|