C29H27FN2O4S — CID 30131464
N-benzhydryl-2-[4-[(2-fluorophenyl)methyl-methylsulfonylamino]phenoxy]acetamide (PubChem CID 30131464) has the molecular formula C29H27FN2O4S and a molecular weight of 518.61 g/mol. Its IUPAC name is N-benzhydryl-2-[4-[(2-fluorophenyl)methyl-methylsulfonylamino]phenoxy]acetamide.
| Compound Name | N-benzhydryl-2-[4-[(2-fluorophenyl)methyl-methylsulfonylamino]phenoxy]acetamide |
|---|---|
| PubChem CID | 30131464 |
| Molecular Formula | C29H27FN2O4S |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | N-benzhydryl-2-[4-[(2-fluorophenyl)methyl-methylsulfonylamino]phenoxy]acetamide |
| SMILES | CS(=O)(=O)N(Cc1ccccc1F)c1ccc(OCC(=O)NC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H27FN2O4S/c1-37(34,35)32(20-24-14-8-9-15-27(24)30)25-16-18-26(19-17-25)36-21-28(33)31-29(22-10-4-2-5-11-22)23-12-6-3-7-13-23/h2-19,29H,20-21H2,1H3,(H,31,33) |
| InChIKey | DFOSDPYGIMBZFD-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |