C15H23N5O3 — CID 30131630
ethyl 4-[[(4,6-dimethylpyrimidin-2-yl)amino]carbamoyl]piperidine-1-carboxylate (PubChem CID 30131630) has the molecular formula C15H23N5O3 and a molecular weight of 321.38 g/mol. Its IUPAC name is ethyl 4-[[(4,6-dimethylpyrimidin-2-yl)amino]carbamoyl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[(4,6-dimethylpyrimidin-2-yl)amino]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 30131630 |
| Molecular Formula | C15H23N5O3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | ethyl 4-[[(4,6-dimethylpyrimidin-2-yl)amino]carbamoyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(C(=O)NNc2nc(C)cc(C)n2)CC1 |
| InChI | InChI=1S/C15H23N5O3/c1-4-23-15(22)20-7-5-12(6-8-20)13(21)18-19-14-16-10(2)9-11(3)17-14/h9,12H,4-8H2,1-3H3,(H,18,21)(H,16,17,19) |
| InChIKey | BEFCMMOGAIWNQU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|