C35H41N3O7S — CID 3013204
methyl 4-[[[(4R)-3-[(2S,3S)-3-[[2-(2,6-dimethylphenoxy)acetyl]amino]-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carbonyl]amino]methyl]benzoate (PubChem CID 3013204) has the molecular formula C35H41N3O7S and a molecular weight of 647.79 g/mol. Its IUPAC name is methyl 4-[[[(4R)-3-[(2S,3S)-3-[[2-(2,6-dimethylphenoxy)acetyl]amino]-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carbonyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[(4R)-3-[(2S,3S)-3-[[2-(2,6-dimethylphenoxy)acetyl]amino]-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carbonyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 3013204 |
| Molecular Formula | C35H41N3O7S |
| Molecular Weight | 647.79 g/mol |
| Exact Mass | 647.27 |
| IUPAC Name | methyl 4-[[[(4R)-3-[(2S,3S)-3-[[2-(2,6-dimethylphenoxy)acetyl]amino]-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carbonyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)[C@H]2N(C(=O)[C@@H](O)[C@H](Cc3ccccc3)NC(=O)COc3c(C)cccc3C)CSC2(C)C)cc1 |
| InChI | InChI=1S/C35H41N3O7S/c1-22-10-9-11-23(2)30(22)45-20-28(39)37-27(18-24-12-7-6-8-13-24)29(40)33(42)38-21-46-35(3,4)31(38)32(41)36-19-25-14-16-26(17-15-25)34(43)44-5/h6-17,27,29,31,40H,18-21H2,1-5H3,(H,36,41)(H,37,39)/t27-,29-,31+/m0/s1 |
| InChIKey | DFIUQRYENWBMRM-DEDOGFMKSA-N |
| XLogP | 3.55 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.79 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |