About 1-(4,6-dimethylpyrimidin-2-yl)-2-[2-(4-ethoxyphenyl)ethyl]guanidine
1-(4,6-dimethylpyrimidin-2-yl)-2-[2-(4-ethoxyphenyl)ethyl]guanidine (PubChem CID 3013234) has the molecular formula C17H23N5O
and a molecular weight of 313.41 g/mol. Its IUPAC name is 1-(4,6-dimethylpyrimidin-2-yl)-2-[2-(4-ethoxyphenyl)ethyl]guanidine.
Molecular Properties
| Compound Name | 1-(4,6-dimethylpyrimidin-2-yl)-2-[2-(4-ethoxyphenyl)ethyl]guanidine |
| PubChem CID | 3013234 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 1-(4,6-dimethylpyrimidin-2-yl)-2-[2-(4-ethoxyphenyl)ethyl]guanidine |
| SMILES | CCOc1ccc(CC/N=C(\N)Nc2nc(C)cc(C)n2)cc1 |
| InChI | InChI=1S/C17H23N5O/c1-4-23-15-7-5-14(6-8-15)9-10-19-16(18)22-17-20-12(2)11-13(3)21-17/h5-8,11H,4,9-10H2,1-3H3,(H3,18,19,20,21,22) |
| InChIKey | JWLKUTGLWKFKKD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,6-dimethylpyrimidin-2-yl)-2-[2-(4-ethoxyphenyl)ethyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,6-dimethylpyrimidin-2-yl)-2-[2-(4-ethoxyphenyl)ethyl]guanidine?
The IUPAC name of 1-(4,6-dimethylpyrimidin-2-yl)-2-[2-(4-ethoxyphenyl)ethyl]guanidine (CID 3013234) is 1-(4,6-dimethylpyrimidin-2-yl)-2-[2-(4-ethoxyphenyl)ethyl]guanidine.
What is the SMILES notation for 1-(4,6-dimethylpyrimidin-2-yl)-2-[2-(4-ethoxyphenyl)ethyl]guanidine?
The canonical SMILES for 1-(4,6-dimethylpyrimidin-2-yl)-2-[2-(4-ethoxyphenyl)ethyl]guanidine is CCOc1ccc(CC/N=C(\N)Nc2nc(C)cc(C)n2)cc1.
What is the InChIKey of 1-(4,6-dimethylpyrimidin-2-yl)-2-[2-(4-ethoxyphenyl)ethyl]guanidine?
The InChIKey is JWLKUTGLWKFKKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N5O/c1-4-23-15-7-5-14(6-8-15)9-10-19-16(18)22-17-20-12(2)11-13(3)21-17/h5-8,11H,4,9-10H2,1-3H3,(H3,18,19,20,21,22).
What are the key properties of 1-(4,6-dimethylpyrimidin-2-yl)-2-[2-(4-ethoxyphenyl)ethyl]guanidine?
1-(4,6-dimethylpyrimidin-2-yl)-2-[2-(4-ethoxyphenyl)ethyl]guanidine has a molecular weight of 313.41 g/mol, XLogP of 2.46, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,6-dimethylpyrimidin-2-yl)-2-[2-(4-ethoxyphenyl)ethyl]guanidine is sourced from PubChem (CID 3013234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).